C25H34FN5O — CID 67013668
7-[(3R,4S)-3-[(1R)-1-amino-2-phenoxyethyl]-4-methylpyrrolidin-1-yl]-1-cyclopropyl-6-fluoro-8-methyl-2,4-dihydroquinazolin-3-amine (PubChem CID 67013668) has the molecular formula C25H34FN5O and a molecular weight of 439.58 g/mol. Its IUPAC name is 7-[(3R,4S)-3-[(1R)-1-amino-2-phenoxyethyl]-4-methylpyrrolidin-1-yl]-1-cyclopropyl-6-fluoro-8-methyl-2,4-dihydroquinazolin-3-amine.
| Compound Name | 7-[(3R,4S)-3-[(1R)-1-amino-2-phenoxyethyl]-4-methylpyrrolidin-1-yl]-1-cyclopropyl-6-fluoro-8-methyl-2,4-dihydroquinazolin-3-amine |
|---|---|
| PubChem CID | 67013668 |
| Molecular Formula | C25H34FN5O |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.27 |
| IUPAC Name | 7-[(3R,4S)-3-[(1R)-1-amino-2-phenoxyethyl]-4-methylpyrrolidin-1-yl]-1-cyclopropyl-6-fluoro-8-methyl-2,4-dihydroquinazolin-3-amine |
| SMILES | Cc1c(N2C[C@H]([C@@H](N)COc3ccccc3)[C@H](C)C2)c(F)cc2c1N(C1CC1)CN(N)C2 |
| InChI | InChI=1S/C25H34FN5O/c1-16-11-29(13-21(16)23(27)14-32-20-6-4-3-5-7-20)25-17(2)24-18(10-22(25)26)12-30(28)15-31(24)19-8-9-19/h3-7,10,16,19,21,23H,8-9,11-15,27-28H2,1-2H3/t16-,21+,23+/m1/s1 |
| InChIKey | AKXQFZIRLAKBHQ-HNKPZJSLSA-N |
| XLogP | 3.23 |
| TPSA | 70.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|