About thiophen-2-ylmethyl N-[4-[3-(4-morpholin-4-ylquinolin-2-yl)prop-2-enoyl]phenyl]carbamate
thiophen-2-ylmethyl N-[4-[3-(4-morpholin-4-ylquinolin-2-yl)prop-2-enoyl]phenyl]carbamate (PubChem CID 67013987) has the molecular formula C28H25N3O4S
and a molecular weight of 499.59 g/mol. Its IUPAC name is thiophen-2-ylmethyl N-[4-[3-(4-morpholin-4-ylquinolin-2-yl)prop-2-enoyl]phenyl]carbamate.
Molecular Properties
| Compound Name | thiophen-2-ylmethyl N-[4-[3-(4-morpholin-4-ylquinolin-2-yl)prop-2-enoyl]phenyl]carbamate |
| PubChem CID | 67013987 |
| Molecular Formula | C28H25N3O4S |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | thiophen-2-ylmethyl N-[4-[3-(4-morpholin-4-ylquinolin-2-yl)prop-2-enoyl]phenyl]carbamate |
| SMILES | O=C(Nc1ccc(C(=O)C=Cc2cc(N3CCOCC3)c3ccccc3n2)cc1)OCc1cccs1 |
| InChI | InChI=1S/C28H25N3O4S/c32-27(20-7-9-21(10-8-20)30-28(33)35-19-23-4-3-17-36-23)12-11-22-18-26(31-13-15-34-16-14-31)24-5-1-2-6-25(24)29-22/h1-12,17-18H,13-16,19H2,(H,30,33) |
| InChIKey | QKQZVTFKTDFYRV-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze thiophen-2-ylmethyl N-[4-[3-(4-morpholin-4-ylquinolin-2-yl)prop-2-enoyl]phenyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiophen-2-ylmethyl N-[4-[3-(4-morpholin-4-ylquinolin-2-yl)prop-2-enoyl]phenyl]carbamate?
The IUPAC name of thiophen-2-ylmethyl N-[4-[3-(4-morpholin-4-ylquinolin-2-yl)prop-2-enoyl]phenyl]carbamate (CID 67013987) is thiophen-2-ylmethyl N-[4-[3-(4-morpholin-4-ylquinolin-2-yl)prop-2-enoyl]phenyl]carbamate.
What is the SMILES notation for thiophen-2-ylmethyl N-[4-[3-(4-morpholin-4-ylquinolin-2-yl)prop-2-enoyl]phenyl]carbamate?
The canonical SMILES for thiophen-2-ylmethyl N-[4-[3-(4-morpholin-4-ylquinolin-2-yl)prop-2-enoyl]phenyl]carbamate is O=C(Nc1ccc(C(=O)C=Cc2cc(N3CCOCC3)c3ccccc3n2)cc1)OCc1cccs1.
What is the InChIKey of thiophen-2-ylmethyl N-[4-[3-(4-morpholin-4-ylquinolin-2-yl)prop-2-enoyl]phenyl]carbamate?
The InChIKey is QKQZVTFKTDFYRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H25N3O4S/c32-27(20-7-9-21(10-8-20)30-28(33)35-19-23-4-3-17-36-23)12-11-22-18-26(31-13-15-34-16-14-31)24-5-1-2-6-25(24)29-22/h1-12,17-18H,13-16,19H2,(H,30,33).
What are the key properties of thiophen-2-ylmethyl N-[4-[3-(4-morpholin-4-ylquinolin-2-yl)prop-2-enoyl]phenyl]carbamate?
thiophen-2-ylmethyl N-[4-[3-(4-morpholin-4-ylquinolin-2-yl)prop-2-enoyl]phenyl]carbamate has a molecular weight of 499.59 g/mol, XLogP of 5.78, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for thiophen-2-ylmethyl N-[4-[3-(4-morpholin-4-ylquinolin-2-yl)prop-2-enoyl]phenyl]carbamate is sourced from PubChem (CID 67013987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).