About 6-[1-(4-fluorophenyl)-2,2-dipyridin-3-ylethyl]-N-pyridin-3-ylpyridin-2-amine
6-[1-(4-fluorophenyl)-2,2-dipyridin-3-ylethyl]-N-pyridin-3-ylpyridin-2-amine (PubChem CID 67014297) has the molecular formula C28H22FN5
and a molecular weight of 447.52 g/mol. Its IUPAC name is 6-[1-(4-fluorophenyl)-2,2-dipyridin-3-ylethyl]-N-pyridin-3-ylpyridin-2-amine.
Molecular Properties
| Compound Name | 6-[1-(4-fluorophenyl)-2,2-dipyridin-3-ylethyl]-N-pyridin-3-ylpyridin-2-amine |
| PubChem CID | 67014297 |
| Molecular Formula | C28H22FN5 |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | 6-[1-(4-fluorophenyl)-2,2-dipyridin-3-ylethyl]-N-pyridin-3-ylpyridin-2-amine |
| SMILES | Fc1ccc(C(c2cccc(Nc3cccnc3)n2)C(c2cccnc2)c2cccnc2)cc1 |
| InChI | InChI=1S/C28H22FN5/c29-23-12-10-20(11-13-23)28(25-8-1-9-26(34-25)33-24-7-4-16-32-19-24)27(21-5-2-14-30-17-21)22-6-3-15-31-18-22/h1-19,27-28H,(H,33,34) |
| InChIKey | SJKWWVYDXSUCMJ-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-[1-(4-fluorophenyl)-2,2-dipyridin-3-ylethyl]-N-pyridin-3-ylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[1-(4-fluorophenyl)-2,2-dipyridin-3-ylethyl]-N-pyridin-3-ylpyridin-2-amine?
The IUPAC name of 6-[1-(4-fluorophenyl)-2,2-dipyridin-3-ylethyl]-N-pyridin-3-ylpyridin-2-amine (CID 67014297) is 6-[1-(4-fluorophenyl)-2,2-dipyridin-3-ylethyl]-N-pyridin-3-ylpyridin-2-amine.
What is the SMILES notation for 6-[1-(4-fluorophenyl)-2,2-dipyridin-3-ylethyl]-N-pyridin-3-ylpyridin-2-amine?
The canonical SMILES for 6-[1-(4-fluorophenyl)-2,2-dipyridin-3-ylethyl]-N-pyridin-3-ylpyridin-2-amine is Fc1ccc(C(c2cccc(Nc3cccnc3)n2)C(c2cccnc2)c2cccnc2)cc1.
What is the InChIKey of 6-[1-(4-fluorophenyl)-2,2-dipyridin-3-ylethyl]-N-pyridin-3-ylpyridin-2-amine?
The InChIKey is SJKWWVYDXSUCMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H22FN5/c29-23-12-10-20(11-13-23)28(25-8-1-9-26(34-25)33-24-7-4-16-32-19-24)27(21-5-2-14-30-17-21)22-6-3-15-31-18-22/h1-19,27-28H,(H,33,34).
What are the key properties of 6-[1-(4-fluorophenyl)-2,2-dipyridin-3-ylethyl]-N-pyridin-3-ylpyridin-2-amine?
6-[1-(4-fluorophenyl)-2,2-dipyridin-3-ylethyl]-N-pyridin-3-ylpyridin-2-amine has a molecular weight of 447.52 g/mol, XLogP of 6.11, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[1-(4-fluorophenyl)-2,2-dipyridin-3-ylethyl]-N-pyridin-3-ylpyridin-2-amine is sourced from PubChem (CID 67014297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).