C10H15N5O2S — CID 67014451
N-([1,2,4]triazolo[1,5-a]pyrimidin-5-yl)pentane-1-sulfonamide (PubChem CID 67014451) has the molecular formula C10H15N5O2S and a molecular weight of 269.33 g/mol. Its IUPAC name is N-([1,2,4]triazolo[1,5-a]pyrimidin-5-yl)pentane-1-sulfonamide.
| Compound Name | N-([1,2,4]triazolo[1,5-a]pyrimidin-5-yl)pentane-1-sulfonamide |
|---|---|
| PubChem CID | 67014451 |
| Molecular Formula | C10H15N5O2S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | N-([1,2,4]triazolo[1,5-a]pyrimidin-5-yl)pentane-1-sulfonamide |
| SMILES | CCCCCS(=O)(=O)Nc1ccn2ncnc2n1 |
| InChI | InChI=1S/C10H15N5O2S/c1-2-3-4-7-18(16,17)14-9-5-6-15-10(13-9)11-8-12-15/h5-6,8H,2-4,7H2,1H3,(H,11,12,13,14) |
| InChIKey | GIUSHEGAXCOPBA-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 89.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|