C24H36N2O4 — CID 67015131
2-[[2-[(2-hydroxyphenyl)methyl-(propan-2-yloxymethyl)amino]ethyl-(propan-2-yloxymethyl)amino]methyl]phenol (PubChem CID 67015131) has the molecular formula C24H36N2O4 and a molecular weight of 416.56 g/mol. Its IUPAC name is 2-[[2-[(2-hydroxyphenyl)methyl-(propan-2-yloxymethyl)amino]ethyl-(propan-2-yloxymethyl)amino]methyl]phenol.
| Compound Name | 2-[[2-[(2-hydroxyphenyl)methyl-(propan-2-yloxymethyl)amino]ethyl-(propan-2-yloxymethyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 67015131 |
| Molecular Formula | C24H36N2O4 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.27 |
| IUPAC Name | 2-[[2-[(2-hydroxyphenyl)methyl-(propan-2-yloxymethyl)amino]ethyl-(propan-2-yloxymethyl)amino]methyl]phenol |
| SMILES | CC(C)OCN(CCN(COC(C)C)Cc1ccccc1O)Cc1ccccc1O |
| InChI | InChI=1S/C24H36N2O4/c1-19(2)29-17-25(15-21-9-5-7-11-23(21)27)13-14-26(18-30-20(3)4)16-22-10-6-8-12-24(22)28/h5-12,19-20,27-28H,13-18H2,1-4H3 |
| InChIKey | KWKWMRIRALQXDP-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 65.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|