About 5-cyclohex-2-en-1-yl-1,4-benzothiazepine
5-cyclohex-2-en-1-yl-1,4-benzothiazepine (PubChem CID 67015146) has the molecular formula C15H15NS
and a molecular weight of 241.36 g/mol. Its IUPAC name is 5-cyclohex-2-en-1-yl-1,4-benzothiazepine.
Molecular Properties
| Compound Name | 5-cyclohex-2-en-1-yl-1,4-benzothiazepine |
| PubChem CID | 67015146 |
| Molecular Formula | C15H15NS |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 5-cyclohex-2-en-1-yl-1,4-benzothiazepine |
| SMILES | C1=CC(C2=NC=CSc3ccccc32)CCC1 |
| InChI | InChI=1S/C15H15NS/c1-2-6-12(7-3-1)15-13-8-4-5-9-14(13)17-11-10-16-15/h2,4-6,8-12H,1,3,7H2 |
| InChIKey | XBTKNUWUEPRYFG-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-cyclohex-2-en-1-yl-1,4-benzothiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclohex-2-en-1-yl-1,4-benzothiazepine?
The IUPAC name of 5-cyclohex-2-en-1-yl-1,4-benzothiazepine (CID 67015146) is 5-cyclohex-2-en-1-yl-1,4-benzothiazepine.
What is the SMILES notation for 5-cyclohex-2-en-1-yl-1,4-benzothiazepine?
The canonical SMILES for 5-cyclohex-2-en-1-yl-1,4-benzothiazepine is C1=CC(C2=NC=CSc3ccccc32)CCC1.
What is the InChIKey of 5-cyclohex-2-en-1-yl-1,4-benzothiazepine?
The InChIKey is XBTKNUWUEPRYFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NS/c1-2-6-12(7-3-1)15-13-8-4-5-9-14(13)17-11-10-16-15/h2,4-6,8-12H,1,3,7H2.
What are the key properties of 5-cyclohex-2-en-1-yl-1,4-benzothiazepine?
5-cyclohex-2-en-1-yl-1,4-benzothiazepine has a molecular weight of 241.36 g/mol, XLogP of 4.41, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclohex-2-en-1-yl-1,4-benzothiazepine is sourced from PubChem (CID 67015146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).