C21H26FN3 — CID 67015309
3-fluoro-11,16,19-trimethyl-1,5,14-triazapentacyclo[10.8.1.02,7.08,21.015,20]henicosa-2,6,12(21),14,16-pentaene (PubChem CID 67015309) has the molecular formula C21H26FN3 and a molecular weight of 339.46 g/mol. Its IUPAC name is 3-fluoro-11,16,19-trimethyl-1,5,14-triazapentacyclo[10.8.1.02,7.08,21.015,20]henicosa-2,6,12(21),14,16-pentaene.
| Compound Name | 3-fluoro-11,16,19-trimethyl-1,5,14-triazapentacyclo[10.8.1.02,7.08,21.015,20]henicosa-2,6,12(21),14,16-pentaene |
|---|---|
| PubChem CID | 67015309 |
| Molecular Formula | C21H26FN3 |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.21 |
| IUPAC Name | 3-fluoro-11,16,19-trimethyl-1,5,14-triazapentacyclo[10.8.1.02,7.08,21.015,20]henicosa-2,6,12(21),14,16-pentaene |
| SMILES | CC1=CCC(C)C2C1=NCC1=C3C(CCC1C)C1=CNCC(F)=C1N32 |
| InChI | InChI=1S/C21H26FN3/c1-11-6-7-14-16-8-23-10-17(22)21(16)25-19-13(3)5-4-12(2)18(19)24-9-15(11)20(14)25/h4,8,11,13-14,19,23H,5-7,9-10H2,1-3H3 |
| InChIKey | HMZGYGIRBPBSAJ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |