C16H21NO3S — CID 67015795
tert-butyl-[1-[5-(hydroxymethyl)-1-benzothiophen-2-yl]ethyl]carbamic acid (PubChem CID 67015795) has the molecular formula C16H21NO3S and a molecular weight of 307.42 g/mol. Its IUPAC name is tert-butyl-[1-[5-(hydroxymethyl)-1-benzothiophen-2-yl]ethyl]carbamic acid.
| Compound Name | tert-butyl-[1-[5-(hydroxymethyl)-1-benzothiophen-2-yl]ethyl]carbamic acid |
|---|---|
| PubChem CID | 67015795 |
| Molecular Formula | C16H21NO3S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | tert-butyl-[1-[5-(hydroxymethyl)-1-benzothiophen-2-yl]ethyl]carbamic acid |
| SMILES | CC(c1cc2cc(CO)ccc2s1)N(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C16H21NO3S/c1-10(17(15(19)20)16(2,3)4)14-8-12-7-11(9-18)5-6-13(12)21-14/h5-8,10,18H,9H2,1-4H3,(H,19,20) |
| InChIKey | WBTJLUKGSSWZNQ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |