C12H12ClF3N4O — CID 67016035
6-chloro-2-ethoxy-3-[3-(trifluoromethyl)phenyl]-2H-1,3,5-triazin-4-amine (PubChem CID 67016035) has the molecular formula C12H12ClF3N4O and a molecular weight of 320.70 g/mol. Its IUPAC name is 6-chloro-2-ethoxy-3-[3-(trifluoromethyl)phenyl]-2H-1,3,5-triazin-4-amine.
| Compound Name | 6-chloro-2-ethoxy-3-[3-(trifluoromethyl)phenyl]-2H-1,3,5-triazin-4-amine |
|---|---|
| PubChem CID | 67016035 |
| Molecular Formula | C12H12ClF3N4O |
| Molecular Weight | 320.70 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 6-chloro-2-ethoxy-3-[3-(trifluoromethyl)phenyl]-2H-1,3,5-triazin-4-amine |
| SMILES | CCOC1N=C(Cl)N=C(N)N1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H12ClF3N4O/c1-2-21-11-19-9(13)18-10(17)20(11)8-5-3-4-7(6-8)12(14,15)16/h3-6,11H,2H2,1H3,(H2,17,18,19) |
| InChIKey | HHZSEDIARIPKNI-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 63.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.70 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|