C10H7F3N4O2 — CID 67016039
6-[N-(trifluoromethyl)anilino]-1H-1,3,5-triazine-2,4-dione (PubChem CID 67016039) has the molecular formula C10H7F3N4O2 and a molecular weight of 272.19 g/mol. Its IUPAC name is 6-[N-(trifluoromethyl)anilino]-1H-1,3,5-triazine-2,4-dione.
| Compound Name | 6-[N-(trifluoromethyl)anilino]-1H-1,3,5-triazine-2,4-dione |
|---|---|
| PubChem CID | 67016039 |
| Molecular Formula | C10H7F3N4O2 |
| Molecular Weight | 272.19 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 6-[N-(trifluoromethyl)anilino]-1H-1,3,5-triazine-2,4-dione |
| SMILES | O=c1nc(N(c2ccccc2)C(F)(F)F)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C10H7F3N4O2/c11-10(12,13)17(6-4-2-1-3-5-6)7-14-8(18)16-9(19)15-7/h1-5H,(H2,14,15,16,18,19) |
| InChIKey | YNHCXNVVCRJYTQ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 81.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.19 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|