C23H25F3N8O3 — CID 67016049
4-N-[(5-methylfuran-2-yl)methyl]-2-N-[2-(morpholin-4-ylmethyl)-3H-benzimidazol-5-yl]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine (PubChem CID 67016049) has the molecular formula C23H25F3N8O3 and a molecular weight of 518.50 g/mol. Its IUPAC name is 4-N-[(5-methylfuran-2-yl)methyl]-2-N-[2-(morpholin-4-ylmethyl)-3H-benzimidazol-5-yl]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-[(5-methylfuran-2-yl)methyl]-2-N-[2-(morpholin-4-ylmethyl)-3H-benzimidazol-5-yl]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 67016049 |
| Molecular Formula | C23H25F3N8O3 |
| Molecular Weight | 518.50 g/mol |
| Exact Mass | 518.20 |
| IUPAC Name | 4-N-[(5-methylfuran-2-yl)methyl]-2-N-[2-(morpholin-4-ylmethyl)-3H-benzimidazol-5-yl]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1ccc(CNc2nc(Nc3ccc4nc(CN5CCOCC5)[nH]c4c3)nc(OCC(F)(F)F)n2)o1 |
| InChI | InChI=1S/C23H25F3N8O3/c1-14-2-4-16(37-14)11-27-20-31-21(33-22(32-20)36-13-23(24,25)26)28-15-3-5-17-18(10-15)30-19(29-17)12-34-6-8-35-9-7-34/h2-5,10H,6-9,11-13H2,1H3,(H,29,30)(H2,27,28,31,32,33) |
| InChIKey | PXAHPIVXQRBSSP-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 126.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.50 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |