About 2-methylidene-3-[2-methyl-2-(2-methylpropyl)-1,3-dioxolan-4-yl]butanoic acid
2-methylidene-3-[2-methyl-2-(2-methylpropyl)-1,3-dioxolan-4-yl]butanoic acid (PubChem CID 67016466) has the molecular formula C13H22O4
and a molecular weight of 242.31 g/mol. Its IUPAC name is 2-methylidene-3-[2-methyl-2-(2-methylpropyl)-1,3-dioxolan-4-yl]butanoic acid.
Molecular Properties
| Compound Name | 2-methylidene-3-[2-methyl-2-(2-methylpropyl)-1,3-dioxolan-4-yl]butanoic acid |
| PubChem CID | 67016466 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 2-methylidene-3-[2-methyl-2-(2-methylpropyl)-1,3-dioxolan-4-yl]butanoic acid |
| SMILES | C=C(C(=O)O)C(C)C1COC(C)(CC(C)C)O1 |
| InChI | InChI=1S/C13H22O4/c1-8(2)6-13(5)16-7-11(17-13)9(3)10(4)12(14)15/h8-9,11H,4,6-7H2,1-3,5H3,(H,14,15) |
| InChIKey | HDGQXQKEWXCRBR-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylidene-3-[2-methyl-2-(2-methylpropyl)-1,3-dioxolan-4-yl]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylidene-3-[2-methyl-2-(2-methylpropyl)-1,3-dioxolan-4-yl]butanoic acid?
The IUPAC name of 2-methylidene-3-[2-methyl-2-(2-methylpropyl)-1,3-dioxolan-4-yl]butanoic acid (CID 67016466) is 2-methylidene-3-[2-methyl-2-(2-methylpropyl)-1,3-dioxolan-4-yl]butanoic acid.
What is the SMILES notation for 2-methylidene-3-[2-methyl-2-(2-methylpropyl)-1,3-dioxolan-4-yl]butanoic acid?
The canonical SMILES for 2-methylidene-3-[2-methyl-2-(2-methylpropyl)-1,3-dioxolan-4-yl]butanoic acid is C=C(C(=O)O)C(C)C1COC(C)(CC(C)C)O1.
What is the InChIKey of 2-methylidene-3-[2-methyl-2-(2-methylpropyl)-1,3-dioxolan-4-yl]butanoic acid?
The InChIKey is HDGQXQKEWXCRBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O4/c1-8(2)6-13(5)16-7-11(17-13)9(3)10(4)12(14)15/h8-9,11H,4,6-7H2,1-3,5H3,(H,14,15).
What are the key properties of 2-methylidene-3-[2-methyl-2-(2-methylpropyl)-1,3-dioxolan-4-yl]butanoic acid?
2-methylidene-3-[2-methyl-2-(2-methylpropyl)-1,3-dioxolan-4-yl]butanoic acid has a molecular weight of 242.31 g/mol, XLogP of 2.44, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylidene-3-[2-methyl-2-(2-methylpropyl)-1,3-dioxolan-4-yl]butanoic acid is sourced from PubChem (CID 67016466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).