C21H17ClN2O2 — CID 67017024
(3S,4S)-3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-4-(4-chlorophenyl)pyrrolidine-2,5-dione (PubChem CID 67017024) has the molecular formula C21H17ClN2O2 and a molecular weight of 364.83 g/mol. Its IUPAC name is (3S,4S)-3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-4-(4-chlorophenyl)pyrrolidine-2,5-dione.
| Compound Name | (3S,4S)-3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-4-(4-chlorophenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 67017024 |
| Molecular Formula | C21H17ClN2O2 |
| Molecular Weight | 364.83 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | (3S,4S)-3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-4-(4-chlorophenyl)pyrrolidine-2,5-dione |
| SMILES | O=C1NC(=O)[C@H](c2cn3c4c(cccc24)CCC3)[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H17ClN2O2/c22-14-8-6-12(7-9-14)17-18(21(26)23-20(17)25)16-11-24-10-2-4-13-3-1-5-15(16)19(13)24/h1,3,5-9,11,17-18H,2,4,10H2,(H,23,25,26)/t17-,18-/m1/s1 |
| InChIKey | SEOSZAKDVOQLRY-QZTJIDSGSA-N |
| XLogP | 3.76 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.83 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|