About 4,7-bis(4-methylthiophen-2-yl)-2,1,3-benzothiadiazole
4,7-bis(4-methylthiophen-2-yl)-2,1,3-benzothiadiazole (PubChem CID 67017025) has the molecular formula C16H12N2S3
and a molecular weight of 328.49 g/mol. Its IUPAC name is 4,7-bis(4-methylthiophen-2-yl)-2,1,3-benzothiadiazole.
Molecular Properties
| Compound Name | 4,7-bis(4-methylthiophen-2-yl)-2,1,3-benzothiadiazole |
| PubChem CID | 67017025 |
| Molecular Formula | C16H12N2S3 |
| Molecular Weight | 328.49 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | 4,7-bis(4-methylthiophen-2-yl)-2,1,3-benzothiadiazole |
| SMILES | Cc1csc(-c2ccc(-c3cc(C)cs3)c3nsnc23)c1 |
| InChI | InChI=1S/C16H12N2S3/c1-9-5-13(19-7-9)11-3-4-12(14-6-10(2)8-20-14)16-15(11)17-21-18-16/h3-8H,1-2H3 |
| InChIKey | OYAHITSGBBWUEQ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.49 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4,7-bis(4-methylthiophen-2-yl)-2,1,3-benzothiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-bis(4-methylthiophen-2-yl)-2,1,3-benzothiadiazole?
The IUPAC name of 4,7-bis(4-methylthiophen-2-yl)-2,1,3-benzothiadiazole (CID 67017025) is 4,7-bis(4-methylthiophen-2-yl)-2,1,3-benzothiadiazole.
What is the SMILES notation for 4,7-bis(4-methylthiophen-2-yl)-2,1,3-benzothiadiazole?
The canonical SMILES for 4,7-bis(4-methylthiophen-2-yl)-2,1,3-benzothiadiazole is Cc1csc(-c2ccc(-c3cc(C)cs3)c3nsnc23)c1.
What is the InChIKey of 4,7-bis(4-methylthiophen-2-yl)-2,1,3-benzothiadiazole?
The InChIKey is OYAHITSGBBWUEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N2S3/c1-9-5-13(19-7-9)11-3-4-12(14-6-10(2)8-20-14)16-15(11)17-21-18-16/h3-8H,1-2H3.
What are the key properties of 4,7-bis(4-methylthiophen-2-yl)-2,1,3-benzothiadiazole?
4,7-bis(4-methylthiophen-2-yl)-2,1,3-benzothiadiazole has a molecular weight of 328.49 g/mol, XLogP of 5.77, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-bis(4-methylthiophen-2-yl)-2,1,3-benzothiadiazole is sourced from PubChem (CID 67017025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).