C28H34N6O2Si — CID 67017195
2-[3-phenylmethoxy-1-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]cyclobutyl]acetonitrile (PubChem CID 67017195) has the molecular formula C28H34N6O2Si and a molecular weight of 514.71 g/mol. Its IUPAC name is 2-[3-phenylmethoxy-1-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]cyclobutyl]acetonitrile.
| Compound Name | 2-[3-phenylmethoxy-1-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]cyclobutyl]acetonitrile |
|---|---|
| PubChem CID | 67017195 |
| Molecular Formula | C28H34N6O2Si |
| Molecular Weight | 514.71 g/mol |
| Exact Mass | 514.25 |
| IUPAC Name | 2-[3-phenylmethoxy-1-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]cyclobutyl]acetonitrile |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(-c3cnn(C4(CC#N)CC(OCc5ccccc5)C4)c3)ncnc21 |
| InChI | InChI=1S/C28H34N6O2Si/c1-37(2,3)14-13-35-21-33-12-9-25-26(30-20-31-27(25)33)23-17-32-34(18-23)28(10-11-29)15-24(16-28)36-19-22-7-5-4-6-8-22/h4-9,12,17-18,20,24H,10,13-16,19,21H2,1-3H3 |
| InChIKey | VLVFHWBLMPOUAR-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 90.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.71 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|