About 6-azabicyclo[3.1.1]heptane;2-azabicyclo[2.2.2]octane;8-azabicyclo[3.2.1]octane
6-azabicyclo[3.1.1]heptane;2-azabicyclo[2.2.2]octane;8-azabicyclo[3.2.1]octane (PubChem CID 67017433) has the molecular formula C20H37N3
and a molecular weight of 319.54 g/mol. Its IUPAC name is 6-azabicyclo[3.1.1]heptane;2-azabicyclo[2.2.2]octane;8-azabicyclo[3.2.1]octane.
Molecular Properties
| Compound Name | 6-azabicyclo[3.1.1]heptane;2-azabicyclo[2.2.2]octane;8-azabicyclo[3.2.1]octane |
| PubChem CID | 67017433 |
| Molecular Formula | C20H37N3 |
| Molecular Weight | 319.54 g/mol |
| Exact Mass | 319.30 |
| IUPAC Name | 6-azabicyclo[3.1.1]heptane;2-azabicyclo[2.2.2]octane;8-azabicyclo[3.2.1]octane |
| SMILES | C1CC2CC(C1)N2.C1CC2CCC(C1)N2.C1CC2CCC1CN2 |
| InChI | InChI=1S/2C7H13N.C6H11N/c1-3-7-4-2-6(1)5-8-7;1-2-6-4-5-7(3-1)8-6;1-2-5-4-6(3-1)7-5/h2*6-8H,1-5H2;5-7H,1-4H2 |
| InChIKey | QLZHLLCIYOHQTI-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.54 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-azabicyclo[3.1.1]heptane;2-azabicyclo[2.2.2]octane;8-azabicyclo[3.2.1]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-azabicyclo[3.1.1]heptane;2-azabicyclo[2.2.2]octane;8-azabicyclo[3.2.1]octane?
The IUPAC name of 6-azabicyclo[3.1.1]heptane;2-azabicyclo[2.2.2]octane;8-azabicyclo[3.2.1]octane (CID 67017433) is 6-azabicyclo[3.1.1]heptane;2-azabicyclo[2.2.2]octane;8-azabicyclo[3.2.1]octane.
What is the SMILES notation for 6-azabicyclo[3.1.1]heptane;2-azabicyclo[2.2.2]octane;8-azabicyclo[3.2.1]octane?
The canonical SMILES for 6-azabicyclo[3.1.1]heptane;2-azabicyclo[2.2.2]octane;8-azabicyclo[3.2.1]octane is C1CC2CC(C1)N2.C1CC2CCC(C1)N2.C1CC2CCC1CN2.
What is the InChIKey of 6-azabicyclo[3.1.1]heptane;2-azabicyclo[2.2.2]octane;8-azabicyclo[3.2.1]octane?
The InChIKey is QLZHLLCIYOHQTI-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H13N.C6H11N/c1-3-7-4-2-6(1)5-8-7;1-2-6-4-5-7(3-1)8-6;1-2-5-4-6(3-1)7-5/h2*6-8H,1-5H2;5-7H,1-4H2.
What are the key properties of 6-azabicyclo[3.1.1]heptane;2-azabicyclo[2.2.2]octane;8-azabicyclo[3.2.1]octane?
6-azabicyclo[3.1.1]heptane;2-azabicyclo[2.2.2]octane;8-azabicyclo[3.2.1]octane has a molecular weight of 319.54 g/mol, XLogP of 3.34, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-azabicyclo[3.1.1]heptane;2-azabicyclo[2.2.2]octane;8-azabicyclo[3.2.1]octane is sourced from PubChem (CID 67017433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).