C21H29NO3 — CID 67017894
tert-butyl N-(1-phenylmethoxy-3-tricyclo[3.3.1.03,7]nonanyl)carbamate (PubChem CID 67017894) has the molecular formula C21H29NO3 and a molecular weight of 343.47 g/mol. Its IUPAC name is tert-butyl N-(1-phenylmethoxy-3-tricyclo[3.3.1.03,7]nonanyl)carbamate.
| Compound Name | tert-butyl N-(1-phenylmethoxy-3-tricyclo[3.3.1.03,7]nonanyl)carbamate |
|---|---|
| PubChem CID | 67017894 |
| Molecular Formula | C21H29NO3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | tert-butyl N-(1-phenylmethoxy-3-tricyclo[3.3.1.03,7]nonanyl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC12CC3CC1CC(OCc1ccccc1)(C3)C2 |
| InChI | InChI=1S/C21H29NO3/c1-19(2,3)25-18(23)22-21-11-16-9-17(21)12-20(10-16,14-21)24-13-15-7-5-4-6-8-15/h4-8,16-17H,9-14H2,1-3H3,(H,22,23) |
| InChIKey | PICGFAUUKXYJMK-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |