C12H9F2N3O2 — CID 67017938
3-(5,7-difluoro-4H-quinazolin-3-yl)pyrrolidine-2,5-dione (PubChem CID 67017938) has the molecular formula C12H9F2N3O2 and a molecular weight of 265.22 g/mol. Its IUPAC name is 3-(5,7-difluoro-4H-quinazolin-3-yl)pyrrolidine-2,5-dione.
| Compound Name | 3-(5,7-difluoro-4H-quinazolin-3-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 67017938 |
| Molecular Formula | C12H9F2N3O2 |
| Molecular Weight | 265.22 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 3-(5,7-difluoro-4H-quinazolin-3-yl)pyrrolidine-2,5-dione |
| SMILES | O=C1CC(N2C=Nc3cc(F)cc(F)c3C2)C(=O)N1 |
| InChI | InChI=1S/C12H9F2N3O2/c13-6-1-8(14)7-4-17(5-15-9(7)2-6)10-3-11(18)16-12(10)19/h1-2,5,10H,3-4H2,(H,16,18,19) |
| InChIKey | VZYACYPUEHTJIE-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.22 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|