C26H62O3Si7 — CID 67018019
ethyl-tris(2,2,3,6,6-pentamethyloxadisilinan-3-yl)silane (PubChem CID 67018019) has the molecular formula C26H62O3Si7 and a molecular weight of 619.38 g/mol. Its IUPAC name is ethyl-tris(2,2,3,6,6-pentamethyloxadisilinan-3-yl)silane.
| Compound Name | ethyl-tris(2,2,3,6,6-pentamethyloxadisilinan-3-yl)silane |
|---|---|
| PubChem CID | 67018019 |
| Molecular Formula | C26H62O3Si7 |
| Molecular Weight | 619.38 g/mol |
| Exact Mass | 618.31 |
| IUPAC Name | ethyl-tris(2,2,3,6,6-pentamethyloxadisilinan-3-yl)silane |
| SMILES | CC[Si]([Si]1(C)CCC(C)(C)O[Si]1(C)C)([Si]1(C)CCC(C)(C)O[Si]1(C)C)[Si]1(C)CCC(C)(C)O[Si]1(C)C |
| InChI | InChI=1S/C26H62O3Si7/c1-17-36(33(14)21-18-24(2,3)27-30(33,8)9,34(15)22-19-25(4,5)28-31(34,10)11)35(16)23-20-26(6,7)29-32(35,12)13/h17-23H2,1-16H3 |
| InChIKey | JEBXRQYZAWBQOW-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.38 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|