C26H21FN2O3 — CID 67018299
N-[[1-[2-(3-fluorophenyl)benzoyl]azetidin-2-yl]methyl]-1-benzofuran-4-carboxamide (PubChem CID 67018299) has the molecular formula C26H21FN2O3 and a molecular weight of 428.46 g/mol. Its IUPAC name is N-[[1-[2-(3-fluorophenyl)benzoyl]azetidin-2-yl]methyl]-1-benzofuran-4-carboxamide.
| Compound Name | N-[[1-[2-(3-fluorophenyl)benzoyl]azetidin-2-yl]methyl]-1-benzofuran-4-carboxamide |
|---|---|
| PubChem CID | 67018299 |
| Molecular Formula | C26H21FN2O3 |
| Molecular Weight | 428.46 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | N-[[1-[2-(3-fluorophenyl)benzoyl]azetidin-2-yl]methyl]-1-benzofuran-4-carboxamide |
| SMILES | O=C(NCC1CCN1C(=O)c1ccccc1-c1cccc(F)c1)c1cccc2occc12 |
| InChI | InChI=1S/C26H21FN2O3/c27-18-6-3-5-17(15-18)20-7-1-2-8-23(20)26(31)29-13-11-19(29)16-28-25(30)22-9-4-10-24-21(22)12-14-32-24/h1-10,12,14-15,19H,11,13,16H2,(H,28,30) |
| InChIKey | LXPFPBVEBXDCGF-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.46 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |