C12H15N — CID 67018612
2,3,4,4a,4b,5-hexahydro-1H-indeno[2,1-b]pyridine (PubChem CID 67018612) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is 2,3,4,4a,4b,5-hexahydro-1H-indeno[2,1-b]pyridine.
| Compound Name | 2,3,4,4a,4b,5-hexahydro-1H-indeno[2,1-b]pyridine |
|---|---|
| PubChem CID | 67018612 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 2,3,4,4a,4b,5-hexahydro-1H-indeno[2,1-b]pyridine |
| SMILES | C1=CCC2C(=C1)C=C1NCCCC12 |
| InChI | InChI=1S/C12H15N/c1-2-5-10-9(4-1)8-12-11(10)6-3-7-13-12/h1-2,4,8,10-11,13H,3,5-7H2 |
| InChIKey | CINJODFGIBPBSD-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |