C24H30O4S3 — CID 67018636
methyl 2-[3-[(1R,2R)-2-[(3S)-5-(1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetate (PubChem CID 67018636) has the molecular formula C24H30O4S3 and a molecular weight of 478.70 g/mol. Its IUPAC name is methyl 2-[3-[(1R,2R)-2-[(3S)-5-(1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetate.
| Compound Name | methyl 2-[3-[(1R,2R)-2-[(3S)-5-(1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetate |
|---|---|
| PubChem CID | 67018636 |
| Molecular Formula | C24H30O4S3 |
| Molecular Weight | 478.70 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | methyl 2-[3-[(1R,2R)-2-[(3S)-5-(1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetate |
| SMILES | COC(=O)CSCCCS[C@H]1C(=O)CC[C@@H]1C=C[C@@H](O)CCc1cc2ccccc2s1 |
| InChI | InChI=1S/C24H30O4S3/c1-28-23(27)16-29-13-4-14-30-24-17(8-12-21(24)26)7-9-19(25)10-11-20-15-18-5-2-3-6-22(18)31-20/h2-3,5-7,9,15,17,19,24-25H,4,8,10-14,16H2,1H3/t17-,19+,24+/m0/s1 |
| InChIKey | IALJCGVTOBBLGA-RGZWJVDOSA-N |
| XLogP | 5.13 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.70 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|