C20H24BrN3O3 — CID 67018678
2-[(1S)-5-[3-[(5-bromopyrimidin-2-yl)amino]propoxy]-2,3-dihydro-1H-inden-1-yl]butanoic acid (PubChem CID 67018678) has the molecular formula C20H24BrN3O3 and a molecular weight of 434.33 g/mol. Its IUPAC name is 2-[(1S)-5-[3-[(5-bromopyrimidin-2-yl)amino]propoxy]-2,3-dihydro-1H-inden-1-yl]butanoic acid.
| Compound Name | 2-[(1S)-5-[3-[(5-bromopyrimidin-2-yl)amino]propoxy]-2,3-dihydro-1H-inden-1-yl]butanoic acid |
|---|---|
| PubChem CID | 67018678 |
| Molecular Formula | C20H24BrN3O3 |
| Molecular Weight | 434.33 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | 2-[(1S)-5-[3-[(5-bromopyrimidin-2-yl)amino]propoxy]-2,3-dihydro-1H-inden-1-yl]butanoic acid |
| SMILES | CCC(C(=O)O)[C@@H]1CCc2cc(OCCCNc3ncc(Br)cn3)ccc21 |
| InChI | InChI=1S/C20H24BrN3O3/c1-2-16(19(25)26)18-6-4-13-10-15(5-7-17(13)18)27-9-3-8-22-20-23-11-14(21)12-24-20/h5,7,10-12,16,18H,2-4,6,8-9H2,1H3,(H,25,26)(H,22,23,24)/t16?,18-/m0/s1 |
| InChIKey | WDLIOCMRTHAVOC-DAFXYXGESA-N |
| XLogP | 4.26 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.33 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|