C26H28FN3O4 — CID 67019046
2-[(1S)-5-[3-[[5-fluoro-2-(4-methoxyphenyl)pyrimidin-4-yl]methylamino]propoxy]-2,3-dihydro-1H-inden-1-yl]acetic acid (PubChem CID 67019046) has the molecular formula C26H28FN3O4 and a molecular weight of 465.53 g/mol. Its IUPAC name is 2-[(1S)-5-[3-[[5-fluoro-2-(4-methoxyphenyl)pyrimidin-4-yl]methylamino]propoxy]-2,3-dihydro-1H-inden-1-yl]acetic acid.
| Compound Name | 2-[(1S)-5-[3-[[5-fluoro-2-(4-methoxyphenyl)pyrimidin-4-yl]methylamino]propoxy]-2,3-dihydro-1H-inden-1-yl]acetic acid |
|---|---|
| PubChem CID | 67019046 |
| Molecular Formula | C26H28FN3O4 |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | 2-[(1S)-5-[3-[[5-fluoro-2-(4-methoxyphenyl)pyrimidin-4-yl]methylamino]propoxy]-2,3-dihydro-1H-inden-1-yl]acetic acid |
| SMILES | COc1ccc(-c2ncc(F)c(CNCCCOc3ccc4c(c3)CC[C@H]4CC(=O)O)n2)cc1 |
| InChI | InChI=1S/C26H28FN3O4/c1-33-20-7-5-17(6-8-20)26-29-15-23(27)24(30-26)16-28-11-2-12-34-21-9-10-22-18(13-21)3-4-19(22)14-25(31)32/h5-10,13,15,19,28H,2-4,11-12,14,16H2,1H3,(H,31,32)/t19-/m0/s1 |
| InChIKey | GFQFGNOBZDTGGV-IBGZPJMESA-N |
| XLogP | 4.35 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|