C26H29N3O3 — CID 67019096
2-[(1S)-5-[3-[[5-methyl-2-(3-methylphenyl)pyrimidin-4-yl]amino]propoxy]-2,3-dihydro-1H-inden-1-yl]acetic acid (PubChem CID 67019096) has the molecular formula C26H29N3O3 and a molecular weight of 431.54 g/mol. Its IUPAC name is 2-[(1S)-5-[3-[[5-methyl-2-(3-methylphenyl)pyrimidin-4-yl]amino]propoxy]-2,3-dihydro-1H-inden-1-yl]acetic acid.
| Compound Name | 2-[(1S)-5-[3-[[5-methyl-2-(3-methylphenyl)pyrimidin-4-yl]amino]propoxy]-2,3-dihydro-1H-inden-1-yl]acetic acid |
|---|---|
| PubChem CID | 67019096 |
| Molecular Formula | C26H29N3O3 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | 2-[(1S)-5-[3-[[5-methyl-2-(3-methylphenyl)pyrimidin-4-yl]amino]propoxy]-2,3-dihydro-1H-inden-1-yl]acetic acid |
| SMILES | Cc1cccc(-c2ncc(C)c(NCCCOc3ccc4c(c3)CC[C@H]4CC(=O)O)n2)c1 |
| InChI | InChI=1S/C26H29N3O3/c1-17-5-3-6-21(13-17)26-28-16-18(2)25(29-26)27-11-4-12-32-22-9-10-23-19(14-22)7-8-20(23)15-24(30)31/h3,5-6,9-10,13-14,16,20H,4,7-8,11-12,15H2,1-2H3,(H,30,31)(H,27,28,29)/t20-/m0/s1 |
| InChIKey | HEBHMDJAOHGPCE-FQEVSTJZSA-N |
| XLogP | 5.15 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|