C17H21N3O2 — CID 67019181
N-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-6,7-dimethoxyquinoxalin-2-amine (PubChem CID 67019181) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is N-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-6,7-dimethoxyquinoxalin-2-amine.
| Compound Name | N-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-6,7-dimethoxyquinoxalin-2-amine |
|---|---|
| PubChem CID | 67019181 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | N-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-6,7-dimethoxyquinoxalin-2-amine |
| SMILES | COc1cc2ncc(N[C@H]3C[C@H]4CC[C@H]3C4)nc2cc1OC |
| InChI | InChI=1S/C17H21N3O2/c1-21-15-7-13-14(8-16(15)22-2)20-17(9-18-13)19-12-6-10-3-4-11(12)5-10/h7-12H,3-6H2,1-2H3,(H,19,20)/t10-,11-,12-/m0/s1 |
| InChIKey | WDTKJTQWHUMMDU-SRVKXCTJSA-N |
| XLogP | 3.25 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |