C26H30FN5O5S — CID 67019243
4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-7-methoxy-6-[3-(4-methylsulfonylpiperazin-1-yl)propoxy]quinazoline (PubChem CID 67019243) has the molecular formula C26H30FN5O5S and a molecular weight of 543.62 g/mol. Its IUPAC name is 4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-7-methoxy-6-[3-(4-methylsulfonylpiperazin-1-yl)propoxy]quinazoline.
| Compound Name | 4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-7-methoxy-6-[3-(4-methylsulfonylpiperazin-1-yl)propoxy]quinazoline |
|---|---|
| PubChem CID | 67019243 |
| Molecular Formula | C26H30FN5O5S |
| Molecular Weight | 543.62 g/mol |
| Exact Mass | 543.20 |
| IUPAC Name | 4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-7-methoxy-6-[3-(4-methylsulfonylpiperazin-1-yl)propoxy]quinazoline |
| SMILES | COc1cc2ncnc(Oc3ccc4[nH]c(C)cc4c3F)c2cc1OCCCN1CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C26H30FN5O5S/c1-17-13-18-20(30-17)5-6-22(25(18)27)37-26-19-14-24(23(35-2)15-21(19)28-16-29-26)36-12-4-7-31-8-10-32(11-9-31)38(3,33)34/h5-6,13-16,30H,4,7-12H2,1-3H3 |
| InChIKey | AMABXCVEKLZGKZ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 109.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.62 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|