C27H29ClN4O4 — CID 67019855
7-chloro-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one;5-(2-methylpropyl)-5-prop-2-enyl-1,3-diazinane-2,4,6-trione (PubChem CID 67019855) has the molecular formula C27H29ClN4O4 and a molecular weight of 509.01 g/mol. Its IUPAC name is 7-chloro-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one;5-(2-methylpropyl)-5-prop-2-enyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 7-chloro-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one;5-(2-methylpropyl)-5-prop-2-enyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 67019855 |
| Molecular Formula | C27H29ClN4O4 |
| Molecular Weight | 509.01 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | 7-chloro-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one;5-(2-methylpropyl)-5-prop-2-enyl-1,3-diazinane-2,4,6-trione |
| SMILES | C=CCC1(CC(C)C)C(=O)NC(=O)NC1=O.CN1C(=O)CN=C(c2ccccc2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C16H13ClN2O.C11H16N2O3/c1-19-14-8-7-12(17)9-13(14)16(18-10-15(19)20)11-5-3-2-4-6-11;1-4-5-11(6-7(2)3)8(14)12-10(16)13-9(11)15/h2-9H,10H2,1H3;4,7H,1,5-6H2,2-3H3,(H2,12,13,14,15,16) |
| InChIKey | FAOFVZKRZYUPAM-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.01 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|