C29H23Cl2F3N2O3S — CID 67020194
(2S)-N-[(4R)-6-(4-chlorophenyl)-7-(2-chloro-4-thiophen-3-ylphenyl)-2,2-dimethyl-3,4-dihydropyrano[2,3-b]pyridin-4-yl]-3,3,3-trifluoro-2-hydroxypropanamide (PubChem CID 67020194) has the molecular formula C29H23Cl2F3N2O3S and a molecular weight of 607.48 g/mol. Its IUPAC name is (2S)-N-[(4R)-6-(4-chlorophenyl)-7-(2-chloro-4-thiophen-3-ylphenyl)-2,2-dimethyl-3,4-dihydropyrano[2,3-b]pyridin-4-yl]-3,3,3-trifluoro-2-hydroxypropanamide.
| Compound Name | (2S)-N-[(4R)-6-(4-chlorophenyl)-7-(2-chloro-4-thiophen-3-ylphenyl)-2,2-dimethyl-3,4-dihydropyrano[2,3-b]pyridin-4-yl]-3,3,3-trifluoro-2-hydroxypropanamide |
|---|---|
| PubChem CID | 67020194 |
| Molecular Formula | C29H23Cl2F3N2O3S |
| Molecular Weight | 607.48 g/mol |
| Exact Mass | 606.08 |
| IUPAC Name | (2S)-N-[(4R)-6-(4-chlorophenyl)-7-(2-chloro-4-thiophen-3-ylphenyl)-2,2-dimethyl-3,4-dihydropyrano[2,3-b]pyridin-4-yl]-3,3,3-trifluoro-2-hydroxypropanamide |
| SMILES | CC1(C)C[C@@H](NC(=O)[C@H](O)C(F)(F)F)c2cc(-c3ccc(Cl)cc3)c(-c3ccc(-c4ccsc4)cc3Cl)nc2O1 |
| InChI | InChI=1S/C29H23Cl2F3N2O3S/c1-28(2)13-23(35-26(38)25(37)29(32,33)34)21-12-20(15-3-6-18(30)7-4-15)24(36-27(21)39-28)19-8-5-16(11-22(19)31)17-9-10-40-14-17/h3-12,14,23,25,37H,13H2,1-2H3,(H,35,38)/t23-,25+/m1/s1 |
| InChIKey | OAIKIRUUCFPJKK-NOZRDPDXSA-N |
| XLogP | 8.09 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.48 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |