C19H30O2 — CID 67020436
(8S,9S,10S,13S,14S)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthrene-1,2-diol (PubChem CID 67020436) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is (8S,9S,10S,13S,14S)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthrene-1,2-diol.
| Compound Name | (8S,9S,10S,13S,14S)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthrene-1,2-diol |
|---|---|
| PubChem CID | 67020436 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | (8S,9S,10S,13S,14S)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthrene-1,2-diol |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1CCC3CCC(O)=C(O)[C@]3(C)[C@H]1CC2 |
| InChI | InChI=1S/C19H30O2/c1-18-10-3-4-14(18)13-7-5-12-6-8-16(20)17(21)19(12,2)15(13)9-11-18/h12-15,20-21H,3-11H2,1-2H3/t12?,13-,14-,15-,18-,19-/m0/s1 |
| InChIKey | JTOUPYZAAQCBDQ-YQQVEUKQSA-N |
| XLogP | 5.36 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |