About CID 67020957
CID 67020957 (PubChem CID 67020957) has the molecular formula C12H23O2Si
and a molecular weight of 227.40 g/mol.
Molecular Properties
| Compound Name | CID 67020957 |
| PubChem CID | 67020957 |
| Molecular Formula | C12H23O2Si |
| Molecular Weight | 227.40 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | — |
| SMILES | C[Si](C)OC1(C(C)(C)C)CCCCC1=O |
| InChI | InChI=1S/C12H23O2Si/c1-11(2,3)12(14-15(4)5)9-7-6-8-10(12)13/h6-9H2,1-5H3 |
| InChIKey | BESVKTWNWQXWCL-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 67020957 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 67020957?
The IUPAC name of CID 67020957 (CID 67020957) is not available.
What is the SMILES notation for CID 67020957?
The canonical SMILES for CID 67020957 is C[Si](C)OC1(C(C)(C)C)CCCCC1=O.
What is the InChIKey of CID 67020957?
The InChIKey is BESVKTWNWQXWCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23O2Si/c1-11(2,3)12(14-15(4)5)9-7-6-8-10(12)13/h6-9H2,1-5H3.
What are the key properties of CID 67020957?
CID 67020957 has a molecular weight of 227.40 g/mol, XLogP of 3.18, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 67020957 is sourced from PubChem (CID 67020957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).