C17H15BrN2O2 — CID 67021635
ethyl 2-[4-(5-bromobenzimidazol-1-yl)phenyl]acetate (PubChem CID 67021635) has the molecular formula C17H15BrN2O2 and a molecular weight of 359.22 g/mol. Its IUPAC name is ethyl 2-[4-(5-bromobenzimidazol-1-yl)phenyl]acetate.
| Compound Name | ethyl 2-[4-(5-bromobenzimidazol-1-yl)phenyl]acetate |
|---|---|
| PubChem CID | 67021635 |
| Molecular Formula | C17H15BrN2O2 |
| Molecular Weight | 359.22 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | ethyl 2-[4-(5-bromobenzimidazol-1-yl)phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(-n2cnc3cc(Br)ccc32)cc1 |
| InChI | InChI=1S/C17H15BrN2O2/c1-2-22-17(21)9-12-3-6-14(7-4-12)20-11-19-15-10-13(18)5-8-16(15)20/h3-8,10-11H,2,9H2,1H3 |
| InChIKey | XVWQXOKEUZLSON-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.22 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |