About Methyl 4-amino-2,6-dichlorobenzeneacetate
Methyl 4-amino-2,6-dichlorobenzeneacetate (PubChem CID 67021638) has the molecular formula C9H9Cl2NO2
and a molecular weight of 234.08 g/mol. Its IUPAC name is methyl 2-(4-amino-2,6-dichlorophenyl)acetate.
Molecular Properties
| Compound Name | Methyl 4-amino-2,6-dichlorobenzeneacetate |
| PubChem CID | 67021638 |
| Molecular Formula | C9H9Cl2NO2 |
| Molecular Weight | 234.08 g/mol |
| Exact Mass | 233.00 |
| IUPAC Name | methyl 2-(4-amino-2,6-dichlorophenyl)acetate |
| SMILES | COC(=O)CC1=C(C=C(C=C1Cl)N)Cl |
| InChI | InChI=1S/C9H9Cl2NO2/c1-14-9(13)4-6-7(10)2-5(12)3-8(6)11/h2-3H,4,12H2,1H3 |
| InChIKey | CGTBRJDCBUVUBG-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 52.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | 201 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.08 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze Methyl 4-amino-2,6-dichlorobenzeneacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Methyl 4-amino-2,6-dichlorobenzeneacetate?
The IUPAC name of Methyl 4-amino-2,6-dichlorobenzeneacetate (CID 67021638) is methyl 2-(4-amino-2,6-dichlorophenyl)acetate.
What is the SMILES notation for Methyl 4-amino-2,6-dichlorobenzeneacetate?
The canonical SMILES for Methyl 4-amino-2,6-dichlorobenzeneacetate is COC(=O)CC1=C(C=C(C=C1Cl)N)Cl.
What is the InChIKey of Methyl 4-amino-2,6-dichlorobenzeneacetate?
The InChIKey is CGTBRJDCBUVUBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9Cl2NO2/c1-14-9(13)4-6-7(10)2-5(12)3-8(6)11/h2-3H,4,12H2,1H3.
What are the key properties of Methyl 4-amino-2,6-dichlorobenzeneacetate?
Methyl 4-amino-2,6-dichlorobenzeneacetate has a molecular weight of 234.08 g/mol, XLogP of 2.30, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Methyl 4-amino-2,6-dichlorobenzeneacetate is sourced from PubChem (CID 67021638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).