About N,N-dimethylpyridin-4-amine;oxolane
N,N-dimethylpyridin-4-amine;oxolane (PubChem CID 67021647) has the molecular formula C11H18N2O
and a molecular weight of 194.28 g/mol. Its IUPAC name is N,N-dimethylpyridin-4-amine;oxolane.
Molecular Properties
| Compound Name | N,N-dimethylpyridin-4-amine;oxolane |
| PubChem CID | 67021647 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | N,N-dimethylpyridin-4-amine;oxolane |
| SMILES | C1CCOC1.CN(C)c1ccncc1 |
| InChI | InChI=1S/C7H10N2.C4H8O/c1-9(2)7-3-5-8-6-4-7;1-2-4-5-3-1/h3-6H,1-2H3;1-4H2 |
| InChIKey | ZEOGMXRHRCVWCW-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-dimethylpyridin-4-amine;oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylpyridin-4-amine;oxolane?
The IUPAC name of N,N-dimethylpyridin-4-amine;oxolane (CID 67021647) is N,N-dimethylpyridin-4-amine;oxolane.
What is the SMILES notation for N,N-dimethylpyridin-4-amine;oxolane?
The canonical SMILES for N,N-dimethylpyridin-4-amine;oxolane is C1CCOC1.CN(C)c1ccncc1.
What is the InChIKey of N,N-dimethylpyridin-4-amine;oxolane?
The InChIKey is ZEOGMXRHRCVWCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2.C4H8O/c1-9(2)7-3-5-8-6-4-7;1-2-4-5-3-1/h3-6H,1-2H3;1-4H2.
What are the key properties of N,N-dimethylpyridin-4-amine;oxolane?
N,N-dimethylpyridin-4-amine;oxolane has a molecular weight of 194.28 g/mol, XLogP of 1.94, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylpyridin-4-amine;oxolane is sourced from PubChem (CID 67021647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).