C21H31N3O6S — CID 67021709
N-[(1R)-1-[3-(2,2-dimethylpropoxy)phenyl]ethyl]-3-[(2,4-dioxopyrimidin-1-yl)methoxy]propane-1-sulfonamide (PubChem CID 67021709) has the molecular formula C21H31N3O6S and a molecular weight of 453.56 g/mol. Its IUPAC name is N-[(1R)-1-[3-(2,2-dimethylpropoxy)phenyl]ethyl]-3-[(2,4-dioxopyrimidin-1-yl)methoxy]propane-1-sulfonamide.
| Compound Name | N-[(1R)-1-[3-(2,2-dimethylpropoxy)phenyl]ethyl]-3-[(2,4-dioxopyrimidin-1-yl)methoxy]propane-1-sulfonamide |
|---|---|
| PubChem CID | 67021709 |
| Molecular Formula | C21H31N3O6S |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | N-[(1R)-1-[3-(2,2-dimethylpropoxy)phenyl]ethyl]-3-[(2,4-dioxopyrimidin-1-yl)methoxy]propane-1-sulfonamide |
| SMILES | C[C@@H](NS(=O)(=O)CCCOCn1ccc(=O)[nH]c1=O)c1cccc(OCC(C)(C)C)c1 |
| InChI | InChI=1S/C21H31N3O6S/c1-16(17-7-5-8-18(13-17)30-14-21(2,3)4)23-31(27,28)12-6-11-29-15-24-10-9-19(25)22-20(24)26/h5,7-10,13,16,23H,6,11-12,14-15H2,1-4H3,(H,22,25,26)/t16-/m1/s1 |
| InChIKey | SKCXZDDCXCNOFT-MRXNPFEDSA-N |
| XLogP | 2.01 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|