C20H29N3O6S — CID 67021716
3-[(2,4-dioxopyrimidin-1-yl)methoxy]-N-[(1R)-1-[3-(2-methylpropoxy)phenyl]ethyl]propane-1-sulfonamide (PubChem CID 67021716) has the molecular formula C20H29N3O6S and a molecular weight of 439.53 g/mol. Its IUPAC name is 3-[(2,4-dioxopyrimidin-1-yl)methoxy]-N-[(1R)-1-[3-(2-methylpropoxy)phenyl]ethyl]propane-1-sulfonamide.
| Compound Name | 3-[(2,4-dioxopyrimidin-1-yl)methoxy]-N-[(1R)-1-[3-(2-methylpropoxy)phenyl]ethyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 67021716 |
| Molecular Formula | C20H29N3O6S |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 3-[(2,4-dioxopyrimidin-1-yl)methoxy]-N-[(1R)-1-[3-(2-methylpropoxy)phenyl]ethyl]propane-1-sulfonamide |
| SMILES | CC(C)COc1cccc([C@@H](C)NS(=O)(=O)CCCOCn2ccc(=O)[nH]c2=O)c1 |
| InChI | InChI=1S/C20H29N3O6S/c1-15(2)13-29-18-7-4-6-17(12-18)16(3)22-30(26,27)11-5-10-28-14-23-9-8-19(24)21-20(23)25/h4,6-9,12,15-16,22H,5,10-11,13-14H2,1-3H3,(H,21,24,25)/t16-/m1/s1 |
| InChIKey | RGLJKKGWIBLDPC-MRXNPFEDSA-N |
| XLogP | 1.62 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|