About 4-[4-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)-6-thiomorpholin-4-yl-1,3,5-triazin-2-yl]aniline
4-[4-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)-6-thiomorpholin-4-yl-1,3,5-triazin-2-yl]aniline (PubChem CID 67022040) has the molecular formula C19H24N6OS
and a molecular weight of 384.51 g/mol. Its IUPAC name is 4-[4-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)-6-thiomorpholin-4-yl-1,3,5-triazin-2-yl]aniline.
Molecular Properties
| Compound Name | 4-[4-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)-6-thiomorpholin-4-yl-1,3,5-triazin-2-yl]aniline |
| PubChem CID | 67022040 |
| Molecular Formula | C19H24N6OS |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 4-[4-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)-6-thiomorpholin-4-yl-1,3,5-triazin-2-yl]aniline |
| SMILES | Nc1ccc(-c2nc(N3CCSCC3)nc(N3C4CCC3COC4)n2)cc1 |
| InChI | InChI=1S/C19H24N6OS/c20-14-3-1-13(2-4-14)17-21-18(24-7-9-27-10-8-24)23-19(22-17)25-15-5-6-16(25)12-26-11-15/h1-4,15-16H,5-12,20H2 |
| InChIKey | UFABMTLNDXCMAH-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)-6-thiomorpholin-4-yl-1,3,5-triazin-2-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)-6-thiomorpholin-4-yl-1,3,5-triazin-2-yl]aniline?
The IUPAC name of 4-[4-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)-6-thiomorpholin-4-yl-1,3,5-triazin-2-yl]aniline (CID 67022040) is 4-[4-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)-6-thiomorpholin-4-yl-1,3,5-triazin-2-yl]aniline.
What is the SMILES notation for 4-[4-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)-6-thiomorpholin-4-yl-1,3,5-triazin-2-yl]aniline?
The canonical SMILES for 4-[4-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)-6-thiomorpholin-4-yl-1,3,5-triazin-2-yl]aniline is Nc1ccc(-c2nc(N3CCSCC3)nc(N3C4CCC3COC4)n2)cc1.
What is the InChIKey of 4-[4-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)-6-thiomorpholin-4-yl-1,3,5-triazin-2-yl]aniline?
The InChIKey is UFABMTLNDXCMAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24N6OS/c20-14-3-1-13(2-4-14)17-21-18(24-7-9-27-10-8-24)23-19(22-17)25-15-5-6-16(25)12-26-11-15/h1-4,15-16H,5-12,20H2.
What are the key properties of 4-[4-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)-6-thiomorpholin-4-yl-1,3,5-triazin-2-yl]aniline?
4-[4-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)-6-thiomorpholin-4-yl-1,3,5-triazin-2-yl]aniline has a molecular weight of 384.51 g/mol, XLogP of 2.04, 3 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)-6-thiomorpholin-4-yl-1,3,5-triazin-2-yl]aniline is sourced from PubChem (CID 67022040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).