C17H21Cl2N3O5S — CID 67022086
3,5-dichloro-N-[5-[(2,4-dioxopyrimidin-1-yl)methoxy]-2-methylpentan-2-yl]benzenesulfonamide (PubChem CID 67022086) has the molecular formula C17H21Cl2N3O5S and a molecular weight of 450.34 g/mol. Its IUPAC name is 3,5-dichloro-N-[5-[(2,4-dioxopyrimidin-1-yl)methoxy]-2-methylpentan-2-yl]benzenesulfonamide.
| Compound Name | 3,5-dichloro-N-[5-[(2,4-dioxopyrimidin-1-yl)methoxy]-2-methylpentan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 67022086 |
| Molecular Formula | C17H21Cl2N3O5S |
| Molecular Weight | 450.34 g/mol |
| Exact Mass | 449.06 |
| IUPAC Name | 3,5-dichloro-N-[5-[(2,4-dioxopyrimidin-1-yl)methoxy]-2-methylpentan-2-yl]benzenesulfonamide |
| SMILES | CC(C)(CCCOCn1ccc(=O)[nH]c1=O)NS(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C17H21Cl2N3O5S/c1-17(2,21-28(25,26)14-9-12(18)8-13(19)10-14)5-3-7-27-11-22-6-4-15(23)20-16(22)24/h4,6,8-10,21H,3,5,7,11H2,1-2H3,(H,20,23,24) |
| InChIKey | NVZPZZUOLHSVHS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|