C36H28N12 — CID 67022214
5,10,15,20-tetrakis(1-methylimidazol-2-yl)porphyrin (PubChem CID 67022214) has the molecular formula C36H28N12 and a molecular weight of 628.70 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(1-methylimidazol-2-yl)porphyrin.
| Compound Name | 5,10,15,20-tetrakis(1-methylimidazol-2-yl)porphyrin |
|---|---|
| PubChem CID | 67022214 |
| Molecular Formula | C36H28N12 |
| Molecular Weight | 628.70 g/mol |
| Exact Mass | 628.26 |
| IUPAC Name | 5,10,15,20-tetrakis(1-methylimidazol-2-yl)porphyrin |
| SMILES | Cn1ccnc1/C1=C2\C=CC(=N2)/C(c2nccn2C)=C2/C=CC(=N2)/C(c2nccn2C)=C2/C=CC(=N2)/C(c2nccn2C)=C2/C=CC1=N2 |
| InChI | InChI=1S/C36H28N12/c1-45-17-13-37-33(45)29-21-5-7-23(41-21)30(34-38-14-18-46(34)2)25-9-11-27(43-25)32(36-40-16-20-48(36)4)28-12-10-26(44-28)31(24-8-6-22(29)42-24)35-39-15-19-47(35)3/h5-20H,1-4H3/b29-21+,29-22+,30-23+,30-25+,31-24+,31-26+,32-27+,32-28+ |
| InChIKey | MMACEPNIMRLGCD-QQZXBORTSA-N |
| XLogP | 4.62 |
| TPSA | 120.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.70 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |