C22H29ClN4O3 — CID 67022568
(2R,4aR,10bR)-6-[2-(dimethylamino)pyrimidin-5-yl]-9-ethoxy-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-ol;hydrochloride (PubChem CID 67022568) has the molecular formula C22H29ClN4O3 and a molecular weight of 432.95 g/mol. Its IUPAC name is (2R,4aR,10bR)-6-[2-(dimethylamino)pyrimidin-5-yl]-9-ethoxy-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-ol;hydrochloride.
| Compound Name | (2R,4aR,10bR)-6-[2-(dimethylamino)pyrimidin-5-yl]-9-ethoxy-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-ol;hydrochloride |
|---|---|
| PubChem CID | 67022568 |
| Molecular Formula | C22H29ClN4O3 |
| Molecular Weight | 432.95 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | (2R,4aR,10bR)-6-[2-(dimethylamino)pyrimidin-5-yl]-9-ethoxy-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-ol;hydrochloride |
| SMILES | CCOc1cc2c(cc1OC)C(c1cnc(N(C)C)nc1)=N[C@@H]1CC[C@@H](O)C[C@H]21.Cl |
| InChI | InChI=1S/C22H28N4O3.ClH/c1-5-29-20-9-15-16-8-14(27)6-7-18(16)25-21(17(15)10-19(20)28-4)13-11-23-22(24-12-13)26(2)3;/h9-12,14,16,18,27H,5-8H2,1-4H3;1H/t14-,16-,18-;/m1./s1 |
| InChIKey | LUNHENOJUZMYLP-AHFLGXKJSA-N |
| XLogP | 3.22 |
| TPSA | 80.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.95 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |