About [(3S,4R)-4-(isoquinolin-6-ylamino)pyrrolidin-3-yl] N-(2-methylphenyl)carbamate
[(3S,4R)-4-(isoquinolin-6-ylamino)pyrrolidin-3-yl] N-(2-methylphenyl)carbamate (PubChem CID 67022675) has the molecular formula C21H22N4O2
and a molecular weight of 362.43 g/mol. Its IUPAC name is [(3S,4R)-4-(isoquinolin-6-ylamino)pyrrolidin-3-yl] N-(2-methylphenyl)carbamate.
Molecular Properties
| Compound Name | [(3S,4R)-4-(isoquinolin-6-ylamino)pyrrolidin-3-yl] N-(2-methylphenyl)carbamate |
| PubChem CID | 67022675 |
| Molecular Formula | C21H22N4O2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | [(3S,4R)-4-(isoquinolin-6-ylamino)pyrrolidin-3-yl] N-(2-methylphenyl)carbamate |
| SMILES | Cc1ccccc1NC(=O)O[C@H]1CNC[C@H]1Nc1ccc2cnccc2c1 |
| InChI | InChI=1S/C21H22N4O2/c1-14-4-2-3-5-18(14)25-21(26)27-20-13-23-12-19(20)24-17-7-6-16-11-22-9-8-15(16)10-17/h2-11,19-20,23-24H,12-13H2,1H3,(H,25,26)/t19-,20+/m1/s1 |
| InChIKey | MWWDHSJLQZYRAD-UXHICEINSA-N |
| XLogP | 3.54 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(3S,4R)-4-(isoquinolin-6-ylamino)pyrrolidin-3-yl] N-(2-methylphenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,4R)-4-(isoquinolin-6-ylamino)pyrrolidin-3-yl] N-(2-methylphenyl)carbamate?
The IUPAC name of [(3S,4R)-4-(isoquinolin-6-ylamino)pyrrolidin-3-yl] N-(2-methylphenyl)carbamate (CID 67022675) is [(3S,4R)-4-(isoquinolin-6-ylamino)pyrrolidin-3-yl] N-(2-methylphenyl)carbamate.
What is the SMILES notation for [(3S,4R)-4-(isoquinolin-6-ylamino)pyrrolidin-3-yl] N-(2-methylphenyl)carbamate?
The canonical SMILES for [(3S,4R)-4-(isoquinolin-6-ylamino)pyrrolidin-3-yl] N-(2-methylphenyl)carbamate is Cc1ccccc1NC(=O)O[C@H]1CNC[C@H]1Nc1ccc2cnccc2c1.
What is the InChIKey of [(3S,4R)-4-(isoquinolin-6-ylamino)pyrrolidin-3-yl] N-(2-methylphenyl)carbamate?
The InChIKey is MWWDHSJLQZYRAD-UXHICEINSA-N. The full InChI is InChI=1S/C21H22N4O2/c1-14-4-2-3-5-18(14)25-21(26)27-20-13-23-12-19(20)24-17-7-6-16-11-22-9-8-15(16)10-17/h2-11,19-20,23-24H,12-13H2,1H3,(H,25,26)/t19-,20+/m1/s1.
What are the key properties of [(3S,4R)-4-(isoquinolin-6-ylamino)pyrrolidin-3-yl] N-(2-methylphenyl)carbamate?
[(3S,4R)-4-(isoquinolin-6-ylamino)pyrrolidin-3-yl] N-(2-methylphenyl)carbamate has a molecular weight of 362.43 g/mol, XLogP of 3.54, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,4R)-4-(isoquinolin-6-ylamino)pyrrolidin-3-yl] N-(2-methylphenyl)carbamate is sourced from PubChem (CID 67022675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).