C44H48N6O9 — CID 67022838
bis[(2S,4aS,10bS)-9-ethoxy-8-methoxy-6-pyrimidin-5-yl-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl] 2-hydroxybutanedioate (PubChem CID 67022838) has the molecular formula C44H48N6O9 and a molecular weight of 804.90 g/mol. Its IUPAC name is bis[(2S,4aS,10bS)-9-ethoxy-8-methoxy-6-pyrimidin-5-yl-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl] 2-hydroxybutanedioate.
| Compound Name | bis[(2S,4aS,10bS)-9-ethoxy-8-methoxy-6-pyrimidin-5-yl-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl] 2-hydroxybutanedioate |
|---|---|
| PubChem CID | 67022838 |
| Molecular Formula | C44H48N6O9 |
| Molecular Weight | 804.90 g/mol |
| Exact Mass | 804.35 |
| IUPAC Name | bis[(2S,4aS,10bS)-9-ethoxy-8-methoxy-6-pyrimidin-5-yl-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl] 2-hydroxybutanedioate |
| SMILES | CCOc1cc2c(cc1OC)C(c1cncnc1)=N[C@H]1CC[C@H](OC(=O)CC(O)C(=O)O[C@H]3CC[C@@H]4N=C(c5cncnc5)c5cc(OC)c(OCC)cc5[C@@H]4C3)C[C@@H]21 |
| InChI | InChI=1S/C44H48N6O9/c1-5-56-39-13-28-30-11-26(7-9-34(30)49-42(24-18-45-22-46-19-24)32(28)15-37(39)54-3)58-41(52)17-36(51)44(53)59-27-8-10-35-31(12-27)29-14-40(57-6-2)38(55-4)16-33(29)43(50-35)25-20-47-23-48-21-25/h13-16,18-23,26-27,30-31,34-36,51H,5-12,17H2,1-4H3/t26-,27-,30-,31-,34-,35-,36?/m0/s1 |
| InChIKey | YLIYEIIUPOQUAX-RLFSDPTQSA-N |
| XLogP | 5.33 |
| TPSA | 186.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.90 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |