C30H42N4O7 — CID 67023589
methyl 2-[[(4S)-4-cyclohexyl-4-[(5-nitro-2-phenoxy-4-pyridinyl)methylamino]butanoyl]amino]-3-[(2-methylpropan-2-yl)oxy]propanoate (PubChem CID 67023589) has the molecular formula C30H42N4O7 and a molecular weight of 570.69 g/mol. Its IUPAC name is methyl 2-[[(4S)-4-cyclohexyl-4-[(5-nitro-2-phenoxy-4-pyridinyl)methylamino]butanoyl]amino]-3-[(2-methylpropan-2-yl)oxy]propanoate.
| Compound Name | methyl 2-[[(4S)-4-cyclohexyl-4-[(5-nitro-2-phenoxy-4-pyridinyl)methylamino]butanoyl]amino]-3-[(2-methylpropan-2-yl)oxy]propanoate |
|---|---|
| PubChem CID | 67023589 |
| Molecular Formula | C30H42N4O7 |
| Molecular Weight | 570.69 g/mol |
| Exact Mass | 570.31 |
| IUPAC Name | methyl 2-[[(4S)-4-cyclohexyl-4-[(5-nitro-2-phenoxy-4-pyridinyl)methylamino]butanoyl]amino]-3-[(2-methylpropan-2-yl)oxy]propanoate |
| SMILES | COC(=O)C(COC(C)(C)C)NC(=O)CC[C@H](NCc1cc(Oc2ccccc2)ncc1[N+](=O)[O-])C1CCCCC1 |
| InChI | InChI=1S/C30H42N4O7/c1-30(2,3)40-20-25(29(36)39-4)33-27(35)16-15-24(21-11-7-5-8-12-21)31-18-22-17-28(32-19-26(22)34(37)38)41-23-13-9-6-10-14-23/h6,9-10,13-14,17,19,21,24-25,31H,5,7-8,11-12,15-16,18,20H2,1-4H3,(H,33,35)/t24-,25?/m0/s1 |
| InChIKey | SXFJMTZEMHTVEM-SKCDSABHSA-N |
| XLogP | 5.07 |
| TPSA | 141.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.69 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|