C23H27FN4O4 — CID 67023793
4-[4-[3-(2-fluorophenyl)-5-methoxy-2-oxo-1H-pyrrolo[2,3-b]pyridin-3-yl]butyl]piperazine-1-carboxylic acid (PubChem CID 67023793) has the molecular formula C23H27FN4O4 and a molecular weight of 442.49 g/mol. Its IUPAC name is 4-[4-[3-(2-fluorophenyl)-5-methoxy-2-oxo-1H-pyrrolo[2,3-b]pyridin-3-yl]butyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[4-[3-(2-fluorophenyl)-5-methoxy-2-oxo-1H-pyrrolo[2,3-b]pyridin-3-yl]butyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 67023793 |
| Molecular Formula | C23H27FN4O4 |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 4-[4-[3-(2-fluorophenyl)-5-methoxy-2-oxo-1H-pyrrolo[2,3-b]pyridin-3-yl]butyl]piperazine-1-carboxylic acid |
| SMILES | COc1cnc2c(c1)C(CCCCN1CCN(C(=O)O)CC1)(c1ccccc1F)C(=O)N2 |
| InChI | InChI=1S/C23H27FN4O4/c1-32-16-14-18-20(25-15-16)26-21(29)23(18,17-6-2-3-7-19(17)24)8-4-5-9-27-10-12-28(13-11-27)22(30)31/h2-3,6-7,14-15H,4-5,8-13H2,1H3,(H,30,31)(H,25,26,29) |
| InChIKey | XFOAQRPQIBSCTK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 95.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|