C17H24N2O2 — CID 67023802
5,5,6-trimethyl-7,8,9,10-tetrahydro-6H-benzo[8]annulene-1,4-dicarboxamide (PubChem CID 67023802) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 5,5,6-trimethyl-7,8,9,10-tetrahydro-6H-benzo[8]annulene-1,4-dicarboxamide.
| Compound Name | 5,5,6-trimethyl-7,8,9,10-tetrahydro-6H-benzo[8]annulene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 67023802 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 5,5,6-trimethyl-7,8,9,10-tetrahydro-6H-benzo[8]annulene-1,4-dicarboxamide |
| SMILES | CC1CCCCc2c(C(N)=O)ccc(C(N)=O)c2C1(C)C |
| InChI | InChI=1S/C17H24N2O2/c1-10-6-4-5-7-11-12(15(18)20)8-9-13(16(19)21)14(11)17(10,2)3/h8-10H,4-7H2,1-3H3,(H2,18,20)(H2,19,21) |
| InChIKey | YCQYNZKBRGZVPK-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |