About 2-oxo-1,3-dihydroindole-4-sulfonamide
2-oxo-1,3-dihydroindole-4-sulfonamide (PubChem CID 67023807) has the molecular formula C8H8N2O3S
and a molecular weight of 212.23 g/mol. Its IUPAC name is 2-oxo-1,3-dihydroindole-4-sulfonamide.
Molecular Properties
| Compound Name | 2-oxo-1,3-dihydroindole-4-sulfonamide |
| PubChem CID | 67023807 |
| Molecular Formula | C8H8N2O3S |
| Molecular Weight | 212.23 g/mol |
| Exact Mass | 212.03 |
| IUPAC Name | 2-oxo-1,3-dihydroindole-4-sulfonamide |
| SMILES | NS(=O)(=O)c1cccc2c1CC(=O)N2 |
| InChI | InChI=1S/C8H8N2O3S/c9-14(12,13)7-3-1-2-6-5(7)4-8(11)10-6/h1-3H,4H2,(H,10,11)(H2,9,12,13) |
| InChIKey | WJDHVNKMNABSBW-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.23 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-oxo-1,3-dihydroindole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-1,3-dihydroindole-4-sulfonamide?
The IUPAC name of 2-oxo-1,3-dihydroindole-4-sulfonamide (CID 67023807) is 2-oxo-1,3-dihydroindole-4-sulfonamide.
What is the SMILES notation for 2-oxo-1,3-dihydroindole-4-sulfonamide?
The canonical SMILES for 2-oxo-1,3-dihydroindole-4-sulfonamide is NS(=O)(=O)c1cccc2c1CC(=O)N2.
What is the InChIKey of 2-oxo-1,3-dihydroindole-4-sulfonamide?
The InChIKey is WJDHVNKMNABSBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O3S/c9-14(12,13)7-3-1-2-6-5(7)4-8(11)10-6/h1-3H,4H2,(H,10,11)(H2,9,12,13).
What are the key properties of 2-oxo-1,3-dihydroindole-4-sulfonamide?
2-oxo-1,3-dihydroindole-4-sulfonamide has a molecular weight of 212.23 g/mol, XLogP of -0.17, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-1,3-dihydroindole-4-sulfonamide is sourced from PubChem (CID 67023807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).