About (5-bromo-2,3-dihydro-1H-inden-1-yl)methanamine
(5-bromo-2,3-dihydro-1H-inden-1-yl)methanamine (PubChem CID 67023940) has the molecular formula C10H12BrN
and a molecular weight of 226.12 g/mol. Its IUPAC name is (5-bromo-2,3-dihydro-1H-inden-1-yl)methanamine.
Molecular Properties
| Compound Name | (5-bromo-2,3-dihydro-1H-inden-1-yl)methanamine |
| PubChem CID | 67023940 |
| Molecular Formula | C10H12BrN |
| Molecular Weight | 226.12 g/mol |
| Exact Mass | 225.02 |
| IUPAC Name | (5-bromo-2,3-dihydro-1H-inden-1-yl)methanamine |
| SMILES | NCC1CCc2cc(Br)ccc21 |
| InChI | InChI=1S/C10H12BrN/c11-9-3-4-10-7(5-9)1-2-8(10)6-12/h3-5,8H,1-2,6,12H2 |
| InChIKey | VWQZJOMQTCXOCG-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.12 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (5-bromo-2,3-dihydro-1H-inden-1-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-bromo-2,3-dihydro-1H-inden-1-yl)methanamine?
The IUPAC name of (5-bromo-2,3-dihydro-1H-inden-1-yl)methanamine (CID 67023940) is (5-bromo-2,3-dihydro-1H-inden-1-yl)methanamine.
What is the SMILES notation for (5-bromo-2,3-dihydro-1H-inden-1-yl)methanamine?
The canonical SMILES for (5-bromo-2,3-dihydro-1H-inden-1-yl)methanamine is NCC1CCc2cc(Br)ccc21.
What is the InChIKey of (5-bromo-2,3-dihydro-1H-inden-1-yl)methanamine?
The InChIKey is VWQZJOMQTCXOCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12BrN/c11-9-3-4-10-7(5-9)1-2-8(10)6-12/h3-5,8H,1-2,6,12H2.
What are the key properties of (5-bromo-2,3-dihydro-1H-inden-1-yl)methanamine?
(5-bromo-2,3-dihydro-1H-inden-1-yl)methanamine has a molecular weight of 226.12 g/mol, XLogP of 2.44, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5-bromo-2,3-dihydro-1H-inden-1-yl)methanamine is sourced from PubChem (CID 67023940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).