C26H26N4O4S — CID 67024026
4-[[4-[2-[methyl-[4-(4-propan-2-ylphenoxy)pyrimidin-2-yl]amino]ethoxy]phenyl]methylidene]-1,3-thiazolidine-2,5-dione (PubChem CID 67024026) has the molecular formula C26H26N4O4S and a molecular weight of 490.59 g/mol. Its IUPAC name is 4-[[4-[2-[methyl-[4-(4-propan-2-ylphenoxy)pyrimidin-2-yl]amino]ethoxy]phenyl]methylidene]-1,3-thiazolidine-2,5-dione.
| Compound Name | 4-[[4-[2-[methyl-[4-(4-propan-2-ylphenoxy)pyrimidin-2-yl]amino]ethoxy]phenyl]methylidene]-1,3-thiazolidine-2,5-dione |
|---|---|
| PubChem CID | 67024026 |
| Molecular Formula | C26H26N4O4S |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | 4-[[4-[2-[methyl-[4-(4-propan-2-ylphenoxy)pyrimidin-2-yl]amino]ethoxy]phenyl]methylidene]-1,3-thiazolidine-2,5-dione |
| SMILES | CC(C)c1ccc(Oc2ccnc(N(C)CCOc3ccc(C=C4NC(=O)SC4=O)cc3)n2)cc1 |
| InChI | InChI=1S/C26H26N4O4S/c1-17(2)19-6-10-21(11-7-19)34-23-12-13-27-25(29-23)30(3)14-15-33-20-8-4-18(5-9-20)16-22-24(31)35-26(32)28-22/h4-13,16-17H,14-15H2,1-3H3,(H,28,32) |
| InChIKey | QUMFUAHGYJIPII-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|