About pyrido[2,3-g]quinoxaline-2-carboxylic acid
pyrido[2,3-g]quinoxaline-2-carboxylic acid (PubChem CID 67024086) has the molecular formula C12H7N3O2
and a molecular weight of 225.21 g/mol. Its IUPAC name is pyrido[2,3-g]quinoxaline-2-carboxylic acid.
Molecular Properties
| Compound Name | pyrido[2,3-g]quinoxaline-2-carboxylic acid |
| PubChem CID | 67024086 |
| Molecular Formula | C12H7N3O2 |
| Molecular Weight | 225.21 g/mol |
| Exact Mass | 225.05 |
| IUPAC Name | pyrido[2,3-g]quinoxaline-2-carboxylic acid |
| SMILES | O=C(O)c1cnc2cc3ncccc3cc2n1 |
| InChI | InChI=1S/C12H7N3O2/c16-12(17)11-6-14-9-5-8-7(2-1-3-13-8)4-10(9)15-11/h1-6H,(H,16,17) |
| InChIKey | MSNYVDJQRBYJDP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.21 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze pyrido[2,3-g]quinoxaline-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrido[2,3-g]quinoxaline-2-carboxylic acid?
The IUPAC name of pyrido[2,3-g]quinoxaline-2-carboxylic acid (CID 67024086) is pyrido[2,3-g]quinoxaline-2-carboxylic acid.
What is the SMILES notation for pyrido[2,3-g]quinoxaline-2-carboxylic acid?
The canonical SMILES for pyrido[2,3-g]quinoxaline-2-carboxylic acid is O=C(O)c1cnc2cc3ncccc3cc2n1.
What is the InChIKey of pyrido[2,3-g]quinoxaline-2-carboxylic acid?
The InChIKey is MSNYVDJQRBYJDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7N3O2/c16-12(17)11-6-14-9-5-8-7(2-1-3-13-8)4-10(9)15-11/h1-6H,(H,16,17).
What are the key properties of pyrido[2,3-g]quinoxaline-2-carboxylic acid?
pyrido[2,3-g]quinoxaline-2-carboxylic acid has a molecular weight of 225.21 g/mol, XLogP of 1.88, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyrido[2,3-g]quinoxaline-2-carboxylic acid is sourced from PubChem (CID 67024086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).