C19H32FNO — CID 67024671
(8R,9R,10S,13S,14S)-17-amino-16-fluoro-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 67024671) has the molecular formula C19H32FNO and a molecular weight of 309.47 g/mol. Its IUPAC name is (8R,9R,10S,13S,14S)-17-amino-16-fluoro-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (8R,9R,10S,13S,14S)-17-amino-16-fluoro-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 67024671 |
| Molecular Formula | C19H32FNO |
| Molecular Weight | 309.47 g/mol |
| Exact Mass | 309.25 |
| IUPAC Name | (8R,9R,10S,13S,14S)-17-amino-16-fluoro-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@]12CCC(O)CC1CC[C@@H]1[C@H]2CC[C@]2(C)C(N)C(F)C[C@@H]12 |
| InChI | InChI=1S/C19H32FNO/c1-18-7-5-12(22)9-11(18)3-4-13-14(18)6-8-19(2)15(13)10-16(20)17(19)21/h11-17,22H,3-10,21H2,1-2H3/t11?,12?,13-,14-,15+,16?,17?,18+,19+/m1/s1 |
| InChIKey | DACUEVZSWREGEJ-CQJJPEBISA-N |
| XLogP | 3.67 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |